Chemindex > 20475-12-1
NO ▼
20475-12-1 tris(2-hydroksyetyl)ammoniumlaktat |
|
| produktnavn | tris(2-hydroksyetyl)ammoniumlaktat |
| Synonymer | Melkesyre, compd.with 2,2',2''-nitrilotri(etanol) (1:1); TE-laktat; Trietanolamin laktat; Propansyre, 2-hydroksy-, compd.med 2,2',2''-nitrilotris (etanol) (1:1); Tris(2-hydroksyetyl)ammoniumlaktat; 2-hydroksypropansyre - 2,2',2''-nitrilotrietanol (1:1); |
| Engelsk navn | tris(2-hydroxyethyl)ammonium lactate;Lactic acid, compd. with 2,2',2''-nitrilotri(ethanol) (1:1);TEA-Lactate;Triethanolamine lactate;Propanoic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium lactate;2-hydroxypropanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekylær Formel | C9H21NO6 |
| Molekylvekt | 239.2661 |
| InChI | InChI=1/C6H15NO3.C3H6O3/c8-4-1-7(2-5-9)3-6-10;1-2(4)3(5)6/h8-10H,1-6H2;2,4H,1H3,(H,5,6) |
| CAS-nummer | 20475-12-1 |
| EINECS | 243-846-8 |
| Molecular Structure |  |
| Kokepunkt | 335.4°C at 760 mmHg |
| Flammepunktet | 185°C |
| Damptrykk | 8.38E-06mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 20475-12-1 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 