ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone |
|
produktnavn | alpha-Bromo-4-(diethylamino)acetophenone |
Engelsk navn | alpha-Bromo-4-(diethylamino)acetophenone;4-(Diethylamino)phenacyl bromide;2-bromo-1-[4-(diethylamino)phenyl]ethanone |
Molekylær Formel | C12H16BrNO |
Molekylvekt | 270.1655 |
InChI | InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
CAS-nummer | 207986-25-2 |
Molecular Structure | ![]() |
Tetthet | 1.316g/cm3 |
Kokepunkt | 357.7°C at 760 mmHg |
Brytningsindeks | 1.572 |
Flammepunktet | 170.1°C |
Damptrykk | 2.69E-05mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |