ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21239-29-2 Ethyl 3,5-dimethylbenzoate |
|
produktnavn | Ethyl 3,5-dimethylbenzoate |
Engelsk navn | Ethyl 3,5-dimethylbenzoate;3,5-Dimethylbenzoic acid ethyl ester |
Molekylær Formel | C11H14O2 |
Molekylvekt | 178.2277 |
InChI | InChI=1/C11H14O2/c1-4-13-11(12)10-6-8(2)5-9(3)7-10/h5-7H,4H2,1-3H3 |
CAS-nummer | 21239-29-2 |
EINECS | 244-286-7 |
Molecular Structure | ![]() |
Tetthet | 1.01g/cm3 |
Kokepunkt | 260.9°C at 760 mmHg |
Brytningsindeks | 1.504 |
Flammepunktet | 115.4°C |
Damptrykk | 0.0119mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |