Chemindex > 216019-28-2
NO ▼
216019-28-2 3-Isopropylbenzeneboronic acid |
|
| produktnavn | 3-Isopropylbenzeneboronic acid |
| Engelsk navn | 3-Isopropylbenzeneboronic acid;3-Cumylboronic acid;3-Isopropylphenylboronic acid;(3-Isopropylphenyl)boronic acid;[3-(1-methylethyl)phenyl]boronic acid;3-isopropylphenylboronicacid;3-Isoprophenylboronic Acid |
| Molekylær Formel | C9H13BO2 |
| Molekylvekt | 164.0093 |
| InChI | InChI=1/C9H13BO2/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7,11-12H,1-2H3 |
| CAS-nummer | 216019-28-2 |
| Molecular Structure |  |
| Tetthet | 1.04g/cm3 |
| Kokepunkt | 294.2°C at 760 mmHg |
| Brytningsindeks | 1.513 |
| Flammepunktet | 131.7°C |
| Damptrykk | 0.000747mmHg at 25°C |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 