Chemindex > 22560-21-0
NO ▼
22560-21-0 Potassium triethylborohydride |
|
| produktnavn | Potassium triethylborohydride |
| Engelsk navn | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| Molekylær Formel | C6H16BK |
| Molekylvekt | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| CAS-nummer | 22560-21-0 |
| EINECS | 245-077-3 |
| Molecular Structure |  |
| Hazard symboler |  F##Highly flammable||C##Corrosive:; |
| Risiko Koder | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 