ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24118-21-6 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione |
|
| produktnavn | 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione |
| Engelsk navn | 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione; |
| Molekylær Formel | C6H6Cl2N4O2 |
| Molekylvekt | 237.0434 |
| InChI | InChI=1/C6H6Cl2N4O2/c7-1-3(11-9)6(14)2(8)4(12-10)5(1)13/h11-12H,9-10H2 |
| CAS-nummer | 24118-21-6 |
| Molecular Structure | ![]() |
| Tetthet | 1.74g/cm3 |
| Kokepunkt | 420.7°C at 760 mmHg |
| Brytningsindeks | 1.675 |
| Flammepunktet | 208.2°C |
| Damptrykk | 2.77E-07mmHg at 25°C |
| MSDS | |