ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-08-6 Methyl 2-acetamidobenzoate |
|
produktnavn | Methyl 2-acetamidobenzoate |
Engelsk navn | Methyl 2-acetamidobenzoate;methyl 2-(acetylamino)benzoate;Methyl N-acetylanthranilate;ACETYL-N-METHYL-ANTHRANILATE |
Molekylær Formel | C10H11NO3 |
Molekylvekt | 193.1992 |
InChI | InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
CAS-nummer | 2719-08-6 |
EINECS | 220-318-5 |
Molecular Structure | ![]() |
Tetthet | 1.204g/cm3 |
Smeltepunkt | 97-101℃ |
Kokepunkt | 376.3°C at 760 mmHg |
Brytningsindeks | 1.565 |
Flammepunktet | 181.4°C |
Damptrykk | 7.3E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |