ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28788-42-3 Decahydronaphthalene-d18 |
|
produktnavn | Decahydronaphthalene-d18 |
Engelsk navn | Decahydronaphthalene-d18;Decahydronapthalene-d18;(~2~H_18_)decahydronaphthalene |
Molekylær Formel | C10D18 |
Molekylvekt | 156.3608 |
InChI | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D |
CAS-nummer | 28788-42-3 |
Molecular Structure | ![]() |
Tetthet | 0.986g/cm3 |
Smeltepunkt | -32℃ |
Kokepunkt | 190.9°C at 760 mmHg |
Brytningsindeks | 1.469 |
Flammepunktet | 57.2°C |
Damptrykk | 0.735mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |