ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2997-87-7 2-(N-etylanilino)etyl-2-metylprop-2-enoat |
|
| produktnavn | 2-(N-etylanilino)etyl-2-metylprop-2-enoat |
| Synonymer | ; 2-[Etyl(fenyl)amino]etylmetakrylat; 2-propensyre, 2-metyl-, 2-(etylfenylamino)etylester |
| Engelsk navn | 2-(N-ethylanilino)ethyl 2-methylprop-2-enoate;2-[Ethyl(phenyl)amino]ethyl methacrylate;2-propenoic acid, 2-methyl-, 2-(ethylphenylamino)ethyl ester |
| Molekylær Formel | C14H19NO2 |
| Molekylvekt | 233.3062 |
| InChI | InChI=1/C14H19NO2/c1-4-15(13-8-6-5-7-9-13)10-11-17-14(16)12(2)3/h5-9H,2,4,10-11H2,1,3H3 |
| CAS-nummer | 2997-87-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.038g/cm3 |
| Kokepunkt | 341.211°C at 760 mmHg |
| Brytningsindeks | 1.532 |
| Flammepunktet | 121.46°C |
| Damptrykk | 0mmHg at 25°C |
| MSDS | |