ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30877-81-7 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
|
| produktnavn | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone |
| Engelsk navn | 1-(3-amino-4-piperidin-1-ylphenyl)ethanone;1-(3-amino-4-piperidinophenyl)ethan-1-one |
| Molekylær Formel | C13H18N2O |
| Molekylvekt | 218.2948 |
| InChI | InChI=1/C13H18N2O/c1-10(16)11-5-6-13(12(14)9-11)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8,14H2,1H3 |
| CAS-nummer | 30877-81-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.116g/cm3 |
| Kokepunkt | 425.5°C at 760 mmHg |
| Brytningsindeks | 1.582 |
| Flammepunktet | 211.1°C |
| Damptrykk | 1.9E-07mmHg at 25°C |
| MSDS | |