ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31517-37-0 dimethyl bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|
| produktnavn | dimethyl bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| Engelsk navn | dimethyl bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate;Bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylic acid, dimethyl ester;Dimethyl bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| Molekylær Formel | C12H16O4 |
| Molekylvekt | 224.253 |
| InChI | InChI=1/C12H16O4/c1-15-11(13)9-7-3-5-8(6-4-7)10(9)12(14)16-2/h3,5,7-10H,4,6H2,1-2H3 |
| CAS-nummer | 31517-37-0;4545-84-0;5160-98-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.171g/cm3 |
| Kokepunkt | 303.1°C at 760 mmHg |
| Brytningsindeks | 1.501 |
| Flammepunktet | 146.2°C |
| Damptrykk | 0.000952mmHg at 25°C |
| MSDS | |