ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
produktnavn | Monoethylpimelate |
Engelsk navn | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
Molekylær Formel | C9H16O4 |
Molekylvekt | 188.2209 |
InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
CAS-nummer | 33018-91-6 |
EINECS | 251-346-6 |
Molecular Structure | ![]() |
Tetthet | 1.074g/cm3 |
Kokepunkt | 288.7°C at 760 mmHg |
Brytningsindeks | 1.449 |
Flammepunktet | 108°C |
Damptrykk | 0.000581mmHg at 25°C |
Risiko Koder | R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |