Chemindex > 368870-06-8
NO ▼
368870-06-8 1-(4-klorfenetyl)-5-okso-3-pyrrolidinkarboksylsyre |
|
| produktnavn | 1-(4-klorfenetyl)-5-okso-3-pyrrolidinkarboksylsyre |
| Synonymer | 1-[2-(4-klorfenyl)etyl]-5-oksopyrrolidin-3-karboksylsyre; |
| Engelsk navn | 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid;1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| Molekylær Formel | C13H14ClNO3 |
| Molekylvekt | 267.7082 |
| InChI | InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
| CAS-nummer | 368870-06-8 |
| Molecular Structure |  |
| Tetthet | 1.346g/cm3 |
| Smeltepunkt | 148℃ |
| Kokepunkt | 496.6°C at 760 mmHg |
| Brytningsindeks | 1.588 |
| Flammepunktet | 254.1°C |
| Damptrykk | 1.11E-10mmHg at 25°C |
| Hazard symboler |  Xi##Irritant:; |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 368870-06-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 