Chemindex > 370-81-0
NO ▼
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| produktnavn | Oxalic acid bis(cyclohexylidenehydrazide) |
| Engelsk navn | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| Molekylær Formel | C14H22N4O2 |
| Molekylvekt | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| CAS-nummer | 370-81-0 |
| EINECS | 206-729-2 |
| Molecular Structure |  |
| Tetthet | 1.29g/cm3 |
| Smeltepunkt | 208-214℃ |
| Brytningsindeks | 1.625 |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R21/22##Harmful in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk ChemNet Mall for å spørre om prisen på
Oxalic acid bis(cyclohexylidenehydrazide) 370-81-0
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 