ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39828-35-8 2,4- dimethoxybenzoyl chloride |
|
produktnavn | 2,4- dimethoxybenzoyl chloride |
Engelsk navn | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- |
Molekylær Formel | C9H9ClO3 |
Molekylvekt | 200.619 |
InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
CAS-nummer | 39828-35-8 |
Molecular Structure | ![]() |
Tetthet | 1.224g/cm3 |
Smeltepunkt | 58℃ |
Kokepunkt | 306.7°C at 760 mmHg |
Brytningsindeks | 1.52 |
Flammepunktet | 134.1°C |
Damptrykk | 0.000757mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |