ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 39828-35-8 2,4- dimethoxybenzoyl chloride | |
| produktnavn | 2,4- dimethoxybenzoyl chloride | 
| Engelsk navn | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- | 
| Molekylær Formel | C9H9ClO3 | 
| Molekylvekt | 200.619 | 
| InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 | 
| CAS-nummer | 39828-35-8 | 
| Molecular Structure |  | 
| Tetthet | 1.224g/cm3 | 
| Smeltepunkt | 58℃ | 
| Kokepunkt | 306.7°C at 760 mmHg | 
| Brytningsindeks | 1.52 | 
| Flammepunktet | 134.1°C | 
| Damptrykk | 0.000757mmHg at 25°C | 
| Hazard symboler | |
| Risiko Koder | R34##Causes burns.:; | 
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |