ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
| produktnavn | 1-(3-fluorophenyl)ethanol |
| Engelsk navn | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| Molekylær Formel | C8H9FO |
| Molekylvekt | 140.1549 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS-nummer | 402-63-1 |
| EINECS | 206-950-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.123g/cm3 |
| Kokepunkt | 196.2°C at 760 mmHg |
| Brytningsindeks | 1.51 |
| Flammepunktet | 90.1°C |
| Damptrykk | 0.251mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |