ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
41669-40-3 tris(2-hydroksyetyl)ammoniummyristat |
|
| produktnavn | tris(2-hydroksyetyl)ammoniummyristat |
| Synonymer | TE-Myristat; Tetradekansyre, compd.with 2,2',2''-nitrilotris (etanol) (1:1); Trietanolamin myristat; Caswell nr.887C; EPA plantevernmiddel kjemisk kode 079044; Myristinsyre, trietanolaminsalt; Tetradekansyre, compd.med 2,2',2''-nitrilotris (etanol); Tris(2-hydroksyetyl)ammoniummyristat; tetradecanoic syre - 2,2',2''-nitrilotrietanol (1:1); |
| Engelsk navn | tris(2-hydroxyethyl)ammonium myristate;TEA-Myristate;Tetradecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Triethanolamine myristate;Caswell No. 887C;EPA Pesticide Chemical Code 079044;Myristic acid, triethanolamine salt;Tetradecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol);Tris(2-hydroxyethyl)ammonium myristate;tetradecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekylær Formel | C20H43NO5 |
| Molekylvekt | 377.5591 |
| InChI | InChI=1/C14H28O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;8-4-1-7(2-5-9)3-6-10/h2-13H2,1H3,(H,15,16);8-10H,1-6H2 |
| CAS-nummer | 41669-40-3 |
| EINECS | 255-486-9 |
| Molecular Structure | ![]() |
| Kokepunkt | 319.6°C at 760 mmHg |
| Flammepunktet | 144.8°C |
| Damptrykk | 0.000139mmHg at 25°C |
| MSDS | |