ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42601-04-7 3,4-Difluorophenyl isocyanate |
|
produktnavn | 3,4-Difluorophenyl isocyanate |
Engelsk navn | 3,4-Difluorophenyl isocyanate;1,2-difluoro-4-isocyanatobenzene |
Molekylær Formel | C7H3F2NO |
Molekylvekt | 155.1016 |
InChI | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
CAS-nummer | 42601-04-7 |
Molecular Structure | ![]() |
Tetthet | 1.24g/cm3 |
Kokepunkt | 186.4°C at 760 mmHg |
Brytningsindeks | 1.488 |
Flammepunktet | 58.9°C |
Damptrykk | 0.665mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |