Chemindex > 42601-04-7
NO ▼
42601-04-7 3,4-Difluorophenyl isocyanate |
|
| produktnavn | 3,4-Difluorophenyl isocyanate |
| Engelsk navn | 3,4-Difluorophenyl isocyanate;1,2-difluoro-4-isocyanatobenzene |
| Molekylær Formel | C7H3F2NO |
| Molekylvekt | 155.1016 |
| InChI | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| CAS-nummer | 42601-04-7 |
| Molecular Structure |  |
| Tetthet | 1.24g/cm3 |
| Kokepunkt | 186.4°C at 760 mmHg |
| Brytningsindeks | 1.488 |
| Flammepunktet | 58.9°C |
| Damptrykk | 0.665mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 42601-04-7 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 