ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4463-33-6 2,3-Dimethoxytoluene |
|
| produktnavn | 2,3-Dimethoxytoluene |
| Engelsk navn | 2,3-Dimethoxytoluene;3-Methylveratrole;1,2-dimethoxy-3-methylbenzene |
| Molekylær Formel | C9H12O2 |
| Molekylvekt | 152.1904 |
| InChI | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| CAS-nummer | 4463-33-6 |
| EINECS | 224-726-4 |
| Molecular Structure | ![]() |
| Tetthet | 0.99g/cm3 |
| Kokepunkt | 201.4°C at 760 mmHg |
| Brytningsindeks | 1.489 |
| Flammepunktet | 67.6°C |
| Damptrykk | 0.438mmHg at 25°C |
| Risiko Koder | R36/38##Irritating to eyes and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |