Chemindex > 453-11-2
NO ▼
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
| produktnavn | 1-Chloro-3-fluoro-2-propanol |
| Engelsk navn | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
| Molekylær Formel | C3H6ClFO |
| Molekylvekt | 112.5305 |
| InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| CAS-nummer | 453-11-2 |
| Molecular Structure |  |
| Tetthet | 1.212g/cm3 |
| Kokepunkt | 158.1°C at 760 mmHg |
| Brytningsindeks | 1.399 |
| Flammepunktet | 49.4°C |
| Damptrykk | 0.951mmHg at 25°C |
| Risiko Koder | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 453-11-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 