ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4874-42-4 (2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)methyl thiocyanate |
|
| produktnavn | (2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)methyl thiocyanate |
| Engelsk navn | (2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)methyl thiocyanate; |
| Molekylær Formel | C6H5N3O2S |
| Molekylvekt | 183.1878 |
| InChI | InChI=1/C6H5N3O2S/c7-3-12-2-4-1-8-6(11)9-5(4)10/h1H,2H2,(H2,8,9,10,11) |
| CAS-nummer | 4874-42-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.434g/cm3 |
| Brytningsindeks | 1.575 |
| MSDS | |