ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50341-80-5 N-butyl-N-[2-(diethylamino)ethyl]-1-benzofuran-2-carboxamide |
|
| produktnavn | N-butyl-N-[2-(diethylamino)ethyl]-1-benzofuran-2-carboxamide |
| Engelsk navn | N-butyl-N-[2-(diethylamino)ethyl]-1-benzofuran-2-carboxamide; |
| Molekylær Formel | C19H28N2O2 |
| Molekylvekt | 316.4378 |
| InChI | InChI=1/C19H28N2O2/c1-4-7-12-21(14-13-20(5-2)6-3)19(22)18-15-16-10-8-9-11-17(16)23-18/h8-11,15H,4-7,12-14H2,1-3H3 |
| CAS-nummer | 50341-80-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.051g/cm3 |
| Kokepunkt | 443.2°C at 760 mmHg |
| Brytningsindeks | 1.547 |
| Flammepunktet | 221.9°C |
| Damptrykk | 4.71E-08mmHg at 25°C |
| MSDS | |