ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5084-80-0 tris(4-methylphenyl)boroxin |
|
| produktnavn | tris(4-methylphenyl)boroxin |
| Engelsk navn | tris(4-methylphenyl)boroxin;2,4,6-Tris(4-methylphenyl)boroxin;boroxin, 2,4,6-tris(4-methylphenyl)-;Boroxin, tris(4-methylphenyl)- |
| Molekylær Formel | C21H21B3O3 |
| Molekylvekt | 353.8226 |
| InChI | InChI=1/C21H21B3O3/c1-16-4-10-19(11-5-16)22-25-23(20-12-6-17(2)7-13-20)27-24(26-22)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| CAS-nummer | 5084-80-0 |
| Molecular Structure | ![]() |
| Tetthet | 1.09g/cm3 |
| Kokepunkt | 408.9°C at 760 mmHg |
| Brytningsindeks | 1.555 |
| Flammepunktet | 201.1°C |
| Damptrykk | 1.6E-06mmHg at 25°C |
| MSDS | |