ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
515-00-4 (-)-Myrtenol |
|
| produktnavn | (-)-Myrtenol |
| Engelsk navn | (-)-Myrtenol;(-)-pin-2-ene-10-ol;(6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol |
| Molekylær Formel | C10H16O |
| Molekylvekt | 152.2334 |
| InChI | InChI=1/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 |
| CAS-nummer | 515-00-4 |
| EINECS | 208-193-5 |
| Molecular Structure | ![]() |
| Tetthet | 0.991g/cm3 |
| Kokepunkt | 224.8°C at 760 mmHg |
| Brytningsindeks | 1.504 |
| Flammepunktet | 89.4°C |
| Damptrykk | 0.0179mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |