ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55912-20-4 4-Chloro-3-nitrobenzyl alcohol |
|
produktnavn | 4-Chloro-3-nitrobenzyl alcohol |
Engelsk navn | 4-Chloro-3-nitrobenzyl alcohol;4-Chloro-3-nitrobenzenemethanol |
Molekylær Formel | C7H6ClNO3 |
Molekylvekt | 187.58 |
InChI | InChI=1/C7H6ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-3,10H,4H2 |
CAS-nummer | 55912-20-4 |
EINECS | 259-901-4 |
Molecular Structure | ![]() |
Smeltepunkt | 61-65℃ |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |