Chemindex > 56107-02-9
NO ▼
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
| produktnavn | 4-Chloro-3-nitrobenzophenone |
| Engelsk navn | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
| Molekylær Formel | C13H8ClNO3 |
| Molekylvekt | 261.6605 |
| InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| CAS-nummer | 56107-02-9 |
| EINECS | 259-995-7 |
| Molecular Structure |  |
| Tetthet | 1.367g/cm3 |
| Smeltepunkt | 101-107℃ |
| Kokepunkt | 386.5°C at 760 mmHg |
| Brytningsindeks | 1.623 |
| Flammepunktet | 203.4°C |
| Damptrykk | 3.53E-06mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21##Harmful by inhalation and in contact with skin.:; |
| Sikkerhet Beskrivelse | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 