Chemindex > 5989-27-5
NO ▼
5989-27-5 (+)-Limonene |
|
| produktnavn | (+)-Limonene |
| Engelsk navn | (+)-Limonene;D-Limonene;Limonene 145;(R)-p-mentha-1,8-diene;(R)-(+)-4-Isopropenyl-1-methylcyclohexene;(+)-p-Mentha-1,8-diene;(4R)-1-methyl-4-(prop-1-en-2-yl)cyclohexene |
| Molekylær Formel | C10H16 |
| Molekylvekt | 136.234 |
| InChI | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| CAS-nummer | 5989-27-5 |
| EINECS | 227-813-5 |
| Molecular Structure |  |
| Tetthet | 0.834g/cm3 |
| Smeltepunkt | -74℃ |
| Kokepunkt | 175.4°C at 760 mmHg |
| Brytningsindeks | 1.467 |
| Flammepunktet | 42.8°C |
| Damptrykk | 1.54mmHg at 25°C |
| Hazard symboler |  Xi##Irritant||N##Dangerous for the environment:; |
| Risiko Koder | R10##Flammable.||R38##Irritating to skin.||R43##May cause sensitization by skin contact.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Sikkerhet Beskrivelse | S24##Avoid contact with skin.||S37##Wear suitable gloves.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 