ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
625-50-3 N-ethylacetamide |
|
produktnavn | N-ethylacetamide |
Engelsk navn | N-ethylacetamide;Ethylacetamide |
Molekylær Formel | C4H9NO |
Molekylvekt | 87.1204 |
InChI | InChI=1/C4H9NO/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6) |
CAS-nummer | 625-50-3 |
EINECS | 210-896-7 |
Molecular Structure | ![]() |
Tetthet | 0.866g/cm3 |
Kokepunkt | 205°C at 760 mmHg |
Brytningsindeks | 1.397 |
Flammepunktet | 105.4°C |
Damptrykk | 0.256mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |