ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68227-30-5 maursyre, sammensatt med 1,4-diazabicyclo[2.2.2]oktan |
|
produktnavn | maursyre, sammensatt med 1,4-diazabicyclo[2.2.2]oktan |
Synonymer | Maursyre, compd.with 1,4-diazabicyclo(2.2.2)oktan (1:?); Maursyre, compd.med 1,4-diazabicyclo(2.2.2)oktan; Maursyre, forbindelse med 1,4-diazabicyclo(2.2.2)oktan; maursyre - 1,4-diazabicyclo [2.2.2] oktan (1:1); |
Engelsk navn | formic acid, compound with 1,4-diazabicyclo[2.2.2]octane;Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane (1:?);Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane;Formic acid, compound with 1,4-diazabicyclo(2.2.2)octane;formic acid - 1,4-diazabicyclo[2.2.2]octane (1:1) |
Molekylær Formel | C7H14N2O2 |
Molekylvekt | 158.1983 |
InChI | InChI=1/C6H12N2.CH2O2/c1-2-8-5-3-7(1)4-6-8;2-1-3/h1-6H2;1H,(H,2,3) |
CAS-nummer | 68227-30-5 |
EINECS | 269-344-9 |
Molecular Structure | ![]() |
Kokepunkt | 174°C at 760 mmHg |
Flammepunktet | 62.2°C |
Damptrykk | 1.23mmHg at 25°C |
MSDS |