ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-57-5 5-Methylnicotinamide |
|
| produktnavn | 5-Methylnicotinamide |
| Engelsk navn | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
| Molekylær Formel | C7H8N2O |
| Molekylvekt | 136.1512 |
| InChI | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
| CAS-nummer | 70-57-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.157g/cm3 |
| Kokepunkt | 290°C at 760 mmHg |
| Brytningsindeks | 1.561 |
| Flammepunktet | 129.2°C |
| Damptrykk | 0.00213mmHg at 25°C |
| Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |