ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70103-35-4 sebacinsyre, forbindelse med 2,2',2''-nitrilotrietanol |
|
| produktnavn | sebacinsyre, forbindelse med 2,2',2''-nitrilotrietanol |
| Synonymer | Sebacinsyre, forbindelse med 2,2',2''-nitrilotrietanol; dekandisyre - 2,2',2''-nitrilotrietanol (1:1); |
| Engelsk navn | sebacic acid, compound with 2,2',2''-nitrilotriethanol;Sebacic acid, compound with 2,2',2''-nitrilotriethanol;decanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekylær Formel | C16H33NO7 |
| Molekylvekt | 351.4357 |
| InChI | InChI=1/C10H18O4.C6H15NO3/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;8-4-1-7(2-5-9)3-6-10/h1-8H2,(H,11,12)(H,13,14);8-10H,1-6H2 |
| CAS-nummer | 70103-35-4 |
| EINECS | 274-316-4 |
| Molecular Structure | ![]() |
| Kokepunkt | 613.8°C at 760 mmHg |
| Flammepunktet | 325°C |
| Damptrykk | 1.24E-17mmHg at 25°C |
| MSDS | |