ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
| produktnavn | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
| Engelsk navn | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
| Molekylær Formel | C14H8Cl4 |
| Molekylvekt | 318.02 |
| InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
| CAS-nummer | 72-55-9 |
| EINECS | 200-784-6 |
| Molecular Structure | ![]() |
| Smeltepunkt | 87-90℃ |
| Vannløselighet | 0.00000013 g/100 mL |
| Hazard symboler | |
| Risiko Koder | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |