ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
| produktnavn | 2-Chlorobutyryl chloride |
| Engelsk navn | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
| Molekylær Formel | C4H6Cl2O |
| Molekylvekt | 140.9958 |
| InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| CAS-nummer | 7623-11-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.227g/cm3 |
| Kokepunkt | 130.5°C at 760 mmHg |
| Brytningsindeks | 1.44 |
| Flammepunktet | 53.2°C |
| Damptrykk | 9.68mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |