ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7774-96-1 Isoeugenyl formate |
|
| produktnavn | Isoeugenyl formate |
| Engelsk navn | Isoeugenyl formate;2-Methoxy-4-(1-propenyl)phenyl formate;2-Methoxy-4-(1-propen-1-yl)phenyl formate;2-Methoxy-4-propenylphenyl formate;4-(1-Propen-1-yl)-2-methoxyphenyl formate;FEMA No. 2474;Phenol, 2-methoxy-4-(1-propenyl)-, formate;Phenol, 2-methoxy-4-propenyl, formate;2-methoxy-4-[(1E)-prop-1-en-1-yl]phenyl formate |
| Molekylær Formel | C11H12O3 |
| Molekylvekt | 192.2112 |
| InChI | InChI=1/C11H12O3/c1-3-4-9-5-6-10(14-8-12)11(7-9)13-2/h3-8H,1-2H3/b4-3+ |
| CAS-nummer | 7774-96-1 |
| EINECS | 231-884-8 |
| Molecular Structure | ![]() |
| Tetthet | 1.093g/cm3 |
| Kokepunkt | 302°C at 760 mmHg |
| Brytningsindeks | 1.546 |
| Flammepunktet | 122.8°C |
| Damptrykk | 0.00182mmHg at 25°C |
| MSDS | |