ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78902-09-7 Phthalimidoacetaldehyde diethyl acetal |
|
| produktnavn | Phthalimidoacetaldehyde diethyl acetal |
| Engelsk navn | Phthalimidoacetaldehyde diethyl acetal;LABOTEST-BB LT00454122;2-PHTHALIMIDOACETALDEHYDE DIETHYL ACETAL;N-(2,2-DIETHOXYETHYL)PHTHALIMIDE;2-(2,2-diethoxyethyl)-1H-isoindole-1,3(2H)-dione;2-(Phthalimido)acetaldehyde diethylacetal;2-(2,2-Diethoxyethyl)isoindoline-1,3-dione |
| Molekylær Formel | C14H17NO4 |
| Molekylvekt | 263.2891 |
| InChI | InChI=1/C14H17NO4/c1-3-18-12(19-4-2)9-15-13(16)10-7-5-6-8-11(10)14(15)17/h5-8,12H,3-4,9H2,1-2H3 |
| CAS-nummer | 78902-09-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.2g/cm3 |
| Smeltepunkt | 72-74℃ |
| Kokepunkt | 372.3°C at 760 mmHg |
| Brytningsindeks | 1.541 |
| Flammepunktet | 179°C |
| Damptrykk | 9.7E-06mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |