ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-68-6 Acryloyl chloride |
|
| produktnavn | Acryloyl chloride |
| Engelsk navn | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
| Molekylær Formel | C3H3OCl |
| Molekylvekt | 90.5083 |
| InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| CAS-nummer | 814-68-6 |
| EINECS | 212-399-0 |
| Molecular Structure | ![]() |
| Tetthet | 1.108g/cm3 |
| Kokepunkt | 75.5°C at 760 mmHg |
| Brytningsindeks | 1.417 |
| Flammepunktet | 16.1°C |
| Damptrykk | 105mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R11##Highly flammable.||R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |