ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-19-3 metyl-2-etylheksanoat |
|
| produktnavn | metyl-2-etylheksanoat |
| Synonymer | Heksansyre, 2-etyl-, metylester; AI3-33653; Metyl-2-etylheksanoat |
| Engelsk navn | methyl 2-ethylhexanoate;Hexanoic acid, 2-ethyl-, methyl ester;AI3-33653;Methyl 2-ethylhexanoate |
| Molekylær Formel | C9H18O2 |
| Molekylvekt | 158.238 |
| InChI | InChI=1/C9H18O2/c1-4-6-7-8(5-2)9(10)11-3/h8H,4-7H2,1-3H3 |
| CAS-nummer | 816-19-3 |
| EINECS | 212-429-2 |
| Molecular Structure | ![]() |
| Tetthet | 0.874g/cm3 |
| Kokepunkt | 176.5°C at 760 mmHg |
| Brytningsindeks | 1.416 |
| Flammepunktet | 59.4°C |
| Damptrykk | 1.09mmHg at 25°C |
| MSDS | |