ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-68-8 pentachloronitrobenzene |
|
| produktnavn | pentachloronitrobenzene |
| Engelsk navn | pentachloronitrobenzene;101brandpcnb75wettable;ai-23024;avicol(pesticide);Avicol, pesticide;Batrilex;Benzene,pentachloronitro-;Botrilex |
| Molekylær Formel | C6Cl5NO2 |
| Molekylvekt | 295.34 |
| InChI | InChI=1/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| CAS-nummer | 82-68-8 |
| EINECS | 201-435-0 |
| Molecular Structure | ![]() |
| Tetthet | 1.718 |
| Smeltepunkt | 144℃ |
| Kokepunkt | 328℃ |
| Vannløselighet | Insoluble |
| Hazard symboler | |
| Risiko Koder | R43||R50/53:; |
| Sikkerhet Beskrivelse | S13||S24||S37||S60||S61:; |
| MSDS | |