ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-51-5 2-Ethylanthraquinone |
|
| produktnavn | 2-Ethylanthraquinone |
| Engelsk navn | 2-Ethylanthraquinone;Ethylanthraquinone;2-Ethyl Anthraquinone;2-ethylanthracene-9,10-dione;Photoinitiator-2-EAQ |
| Molekylær Formel | C16H12O2 |
| Molekylvekt | 236.2653 |
| InChI | InChI=1/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
| CAS-nummer | 84-51-5 |
| EINECS | 201-535-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.231g/cm3 |
| Smeltepunkt | 108-111℃ |
| Kokepunkt | 415.4°C at 760 mmHg |
| Brytningsindeks | 1.629 |
| Flammepunktet | 155.4°C |
| Damptrykk | 4.14E-07mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25:; |
| MSDS | |