ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84298-33-9 4-methyl-9-propoxy-2,4,5,6-tetrahydro-1H-3,4,6a-triazafluoranthene |
|
| produktnavn | 4-methyl-9-propoxy-2,4,5,6-tetrahydro-1H-3,4,6a-triazafluoranthene |
| Engelsk navn | 4-methyl-9-propoxy-2,4,5,6-tetrahydro-1H-3,4,6a-triazafluoranthene; |
| Molekylær Formel | C17H21N3O |
| Molekylvekt | 283.3681 |
| InChI | InChI=1/C17H21N3O/c1-3-10-21-12-4-5-15-14(11-12)13-6-7-18-17-16(13)20(15)9-8-19(17)2/h4-5,11H,3,6-10H2,1-2H3 |
| CAS-nummer | 84298-33-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.26g/cm3 |
| Kokepunkt | 478.4°C at 760 mmHg |
| Brytningsindeks | 1.662 |
| Flammepunktet | 243.1°C |
| Damptrykk | 2.58E-09mmHg at 25°C |
| MSDS | |