ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85441-57-2 (3R, 4S) -3- [(4-metoksyfenoksy) metyl] -4-fenylpiperidin |
|
| produktnavn | (3R, 4S) -3- [(4-metoksyfenoksy) metyl] -4-fenylpiperidin |
| Synonymer | ;(3R, 4S) -3- (4-metoksy-fenoksymetyl) -4-fenyl-piperidin; Piperidin, 3- ((4-metoksyfenoksy) metyl) -4-fenyl-, (3R, 4S) -; |
| Engelsk navn | (3R,4S)-3-[(4-methoxyphenoxy)methyl]-4-phenylpiperidine;(3R,4S)-3-(4-Methoxy-phenoxymethyl)-4-phenyl-piperidine;Piperidine, 3-((4-methoxyphenoxy)methyl)-4-phenyl-, (3R,4S)- |
| Molekylær Formel | C19H23NO2 |
| Molekylvekt | 297.3914 |
| InChI | InChI=1/C19H23NO2/c1-21-17-7-9-18(10-8-17)22-14-16-13-20-12-11-19(16)15-5-3-2-4-6-15/h2-10,16,19-20H,11-14H2,1H3/t16-,19-/m1/s1 |
| CAS-nummer | 85441-57-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.061g/cm3 |
| Kokepunkt | 445°C at 760 mmHg |
| Brytningsindeks | 1.544 |
| Flammepunktet | 187.5°C |
| Damptrykk | 4.09E-08mmHg at 25°C |
| MSDS | |