ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-26-0 2-Methoxybiphenyl |
|
| produktnavn | 2-Methoxybiphenyl |
| Engelsk navn | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
| Molekylær Formel | C13H12O |
| Molekylvekt | 184.2338 |
| InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS-nummer | 86-26-0 |
| EINECS | 201-659-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.03g/cm3 |
| Smeltepunkt | 30-33℃ |
| Kokepunkt | 274°C at 760 mmHg |
| Brytningsindeks | 1.556 |
| Flammepunktet | 101.3°C |
| Damptrykk | 0.00928mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R33##Danger of cummulative effects.:; |
| Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |