ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-08-1 phenoxymethyl penicillinic acid*free acid |
|
| produktnavn | phenoxymethyl penicillinic acid*free acid |
| Engelsk navn | phenoxymethyl penicillinic acid*free acid;phenoxymethylpenicillin;Penicillin V |
| Molekylær Formel | C16H18N2O5S |
| Molekylvekt | 350.38 |
| InChI | InChI=1/C16H18N2O5S/c1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1 |
| CAS-nummer | 87-08-1 |
| EINECS | 201-722-0 |
| Molecular Structure | ![]() |
| MSDS | |