ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
| Nazwa produktu: | 3-Hydroxyphenylacetylene |
| Angielska nazwa | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
| MF | C8H6O |
| Masie cząsteczkowej | 118.1326 |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| Nr CAS | 10401-11-3 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.12g/cm3 |
| Temperatura wrzenia | 230.9°C at 760 mmHg |
| Współczynnik załamania | 1.589 |
| Temperatura zapłonu | 106.1°C |
| Ciśnienie pary | 0.0424mmHg at 25°C |
| Kody ryzyka | R36/38##Irritating to eyes and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |