ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2423-71-4 2,6-Dimethyl-4-nitrophenol |
|
Nazwa produktu: | 2,6-Dimethyl-4-nitrophenol |
Angielska nazwa | 2,6-Dimethyl-4-nitrophenol;4-Nitro-2,6-xylenol;2,6-dimethyl-4-nitrophenolate |
MF | C8H8NO3 |
Masie cząsteczkowej | 166.1546 |
InChI | InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
Nr CAS | 2423-71-4 |
EINECS | 219-353-9 |
Struktury molekularnej | ![]() |
Temperatura topnienia | 164℃ |
Temperatura wrzenia | 322.8°C at 760 mmHg |
Temperatura zapłonu | 145.3°C |
Ciśnienie pary | 0.000145mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.||R41##Risks of serious damage to eyes.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |