ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine |
|
| Nazwa produktu: | Acridine |
| Angielska nazwa | Acridine;Dibenzo[b,e]pyridine |
| MF | C13H9N |
| Masie cząsteczkowej | 179.2173 |
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| Nr CAS | 260-94-6 |
| EINECS | 205-971-6 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.187g/cm3 |
| Temperatura topnienia | 105-110℃ |
| Temperatura wrzenia | 346.7°C at 760 mmHg |
| Współczynnik załamania | 1.726 |
| Temperatura zapłonu | 153.8°C |
| Ciśnienie pary | 0.000113mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |