ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3282-11-9 4,4''-Dinitro-p-terphenyl |
|
Nazwa produktu: | 4,4''-Dinitro-p-terphenyl |
Angielska nazwa | 4,4''-Dinitro-p-terphenyl;p-Terphenyl, 4,4''-dinitro-;4,4''-dinitro-1,1':4',1''-terphenyl |
MF | C18H12N2O4 |
Masie cząsteczkowej | 320.2989 |
InChI | InChI=1/C18H12N2O4/c21-19(22)17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(12-8-16)20(23)24/h1-12H |
Nr CAS | 3282-11-9 |
Struktury molekularnej | ![]() |
Gęstość | 1.314g/cm3 |
Temperatura wrzenia | 534.4°C at 760 mmHg |
Współczynnik załamania | 1.646 |
Temperatura zapłonu | 260.2°C |
Ciśnienie pary | 5.85E-11mmHg at 25°C |
Kody ryzyka | R20/22##Harmful by inhalation and if swallowed.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |