ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 39828-35-8 2,4- dimethoxybenzoyl chloride | |
| Nazwa produktu: | 2,4- dimethoxybenzoyl chloride | 
| Angielska nazwa | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- | 
| MF | C9H9ClO3 | 
| Masie cząsteczkowej | 200.619 | 
| InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 | 
| Nr CAS | 39828-35-8 | 
| Struktury molekularnej |  | 
| Gęstość | 1.224g/cm3 | 
| Temperatura topnienia | 58℃ | 
| Temperatura wrzenia | 306.7°C at 760 mmHg | 
| Współczynnik załamania | 1.52 | 
| Temperatura zapłonu | 134.1°C | 
| Ciśnienie pary | 0.000757mmHg at 25°C | 
| Symbole zagrożenia | |
| Kody ryzyka | R34##Causes burns.:; | 
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |