ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42601-04-7 3,4-Difluorophenyl isocyanate |
|
Nazwa produktu: | 3,4-Difluorophenyl isocyanate |
Angielska nazwa | 3,4-Difluorophenyl isocyanate;1,2-difluoro-4-isocyanatobenzene |
MF | C7H3F2NO |
Masie cząsteczkowej | 155.1016 |
InChI | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
Nr CAS | 42601-04-7 |
Struktury molekularnej | ![]() |
Gęstość | 1.24g/cm3 |
Temperatura wrzenia | 186.4°C at 760 mmHg |
Współczynnik załamania | 1.488 |
Temperatura zapłonu | 58.9°C |
Ciśnienie pary | 0.665mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |