ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4653-08-1 3-(2-thenoyl)propionic acid | 
    |
| Nazwa produktu: | 3-(2-thenoyl)propionic acid | 
| Angielska nazwa | 3-(2-thenoyl)propionic acid;4-Oxo-4-(2-thienyl)butyric acid;4-oxo-4-(thiophen-2-yl)butanoic acid;4-oxo-4-thiophen-2-ylbutanoate | 
| MF | C8H7O3S | 
| Masie cząsteczkowej | 183.2049 | 
| InChI | InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 | 
| Nr CAS | 4653-08-1 | 
| EINECS | 225-089-5 | 
| Struktury molekularnej | ![]()  | 
    
| Temperatura wrzenia | 400.5°C at 760 mmHg | 
| Temperatura zapłonu | 196°C | 
| Ciśnienie pary | 3.93E-07mmHg at 25°C | 
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |